C20H23ClN2O3 — CID 126393613
N-[4-[[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]phenyl]acetamide (PubChem CID 126393613) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is N-[4-[[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]phenyl]acetamide.
| Compound Name | N-[4-[[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]phenyl]acetamide |
|---|---|
| PubChem CID | 126393613 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[4-[[4-[(2R)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]phenyl]acetamide |
| SMILES | CC[C@@H](C)Oc1c(Cl)cc(/C=N/c2ccc(NC(C)=O)cc2)cc1OC |
| InChI | InChI=1S/C20H23ClN2O3/c1-5-13(2)26-20-18(21)10-15(11-19(20)25-4)12-22-16-6-8-17(9-7-16)23-14(3)24/h6-13H,5H2,1-4H3,(H,23,24)/b22-12+/t13-/m1/s1 |
| InChIKey | ZBAWKCQRHMZUBG-UMYHVIPVSA-N |
| XLogP | 5.23 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|