C19H22ClNO2 — CID 126380326
1-[4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]-N-(4-methylphenyl)methanimine (PubChem CID 126380326) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is 1-[4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]-N-(4-methylphenyl)methanimine.
| Compound Name | 1-[4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]-N-(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126380326 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 1-[4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]-N-(4-methylphenyl)methanimine |
| SMILES | CC[C@H](C)Oc1c(Cl)cc(/C=N/c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C19H22ClNO2/c1-5-14(3)23-19-17(20)10-15(11-18(19)22-4)12-21-16-8-6-13(2)7-9-16/h6-12,14H,5H2,1-4H3/b21-12+/t14-/m0/s1 |
| InChIKey | OPEIKQWFZWTOCR-OMBDHMDGSA-N |
| XLogP | 5.58 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|