C22H23ClIN3O6 — CID 3477206
ethyl 2-[4-[[[4-(3-chloroanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 3477206) has the molecular formula C22H23ClIN3O6 and a molecular weight of 587.80 g/mol. Its IUPAC name is ethyl 2-[4-[[[4-(3-chloroanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[[4-(3-chloroanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3477206 |
| Molecular Formula | C22H23ClIN3O6 |
| Molecular Weight | 587.80 g/mol |
| Exact Mass | 587.03 |
| IUPAC Name | ethyl 2-[4-[[[4-(3-chloroanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(C=NNC(=O)CCC(=O)Nc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C22H23ClIN3O6/c1-3-32-21(30)13-33-22-17(24)9-14(10-18(22)31-2)12-25-27-20(29)8-7-19(28)26-16-6-4-5-15(23)11-16/h4-6,9-12H,3,7-8,13H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | ANKRXXPKDPONBQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|