C23H25BrClN3O6 — CID 3952485
ethyl 2-[2-bromo-4-[[[4-(3-chloro-4-methylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 3952485) has the molecular formula C23H25BrClN3O6 and a molecular weight of 554.83 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[[[4-(3-chloro-4-methylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[[[4-(3-chloro-4-methylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3952485 |
| Molecular Formula | C23H25BrClN3O6 |
| Molecular Weight | 554.83 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | ethyl 2-[2-bromo-4-[[[4-(3-chloro-4-methylanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(C=NNC(=O)CCC(=O)Nc2ccc(C)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C23H25BrClN3O6/c1-4-33-22(31)13-34-23-17(24)9-15(10-19(23)32-3)12-26-28-21(30)8-7-20(29)27-16-6-5-14(2)18(25)11-16/h5-6,9-12H,4,7-8,13H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | DQSRQPLFUMMYTL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.83 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|