C21H21BrClN3O5 — CID 3951717
ethyl 2-[2-bromo-4-[[[3-(3-chloro-4-methylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3951717) has the molecular formula C21H21BrClN3O5 and a molecular weight of 510.77 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[[[3-(3-chloro-4-methylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[[[3-(3-chloro-4-methylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3951717 |
| Molecular Formula | C21H21BrClN3O5 |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | ethyl 2-[2-bromo-4-[[[3-(3-chloro-4-methylanilino)-3-oxopropanoyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C=NNC(=O)CC(=O)Nc2ccc(C)c(Cl)c2)cc1Br |
| InChI | InChI=1S/C21H21BrClN3O5/c1-3-30-21(29)12-31-18-7-5-14(8-16(18)22)11-24-26-20(28)10-19(27)25-15-6-4-13(2)17(23)9-15/h4-9,11H,3,10,12H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | ZXWAXLGFIMQZGC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|