C24H25BrClN3O5 — CID 126333458
ethyl 2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-methoxyphenoxy]acetate (PubChem CID 126333458) has the molecular formula C24H25BrClN3O5 and a molecular weight of 550.84 g/mol. Its IUPAC name is ethyl 2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126333458 |
| Molecular Formula | C24H25BrClN3O5 |
| Molecular Weight | 550.84 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | ethyl 2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-4-chloro-6-methoxyphenoxy]acetate |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)cc(OC)c1OCC(=O)OCC |
| InChI | InChI=1S/C24H25BrClN3O5/c1-4-6-7-21-28-19-9-8-16(25)11-18(19)24(31)29(21)27-13-15-10-17(26)12-20(32-3)23(15)34-14-22(30)33-5-2/h8-13H,4-7,14H2,1-3H3 |
| InChIKey | SCQLYOAWZZPQGF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.84 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|