C18H17Cl2N3O5S — CID 2742147
[2-[(carbamothioylhydrazinylidene)methyl]-4,6-dichlorophenyl] 3,4,5-trimethoxybenzoate (PubChem CID 2742147) has the molecular formula C18H17Cl2N3O5S and a molecular weight of 458.32 g/mol. Its IUPAC name is [2-[(carbamothioylhydrazinylidene)methyl]-4,6-dichlorophenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[(carbamothioylhydrazinylidene)methyl]-4,6-dichlorophenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2742147 |
| Molecular Formula | C18H17Cl2N3O5S |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | [2-[(carbamothioylhydrazinylidene)methyl]-4,6-dichlorophenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2c(Cl)cc(Cl)cc2C=NNC(N)=S)cc(OC)c1OC |
| InChI | InChI=1S/C18H17Cl2N3O5S/c1-25-13-5-9(6-14(26-2)16(13)27-3)17(24)28-15-10(8-22-23-18(21)29)4-11(19)7-12(15)20/h4-8H,1-3H3,(H3,21,23,29) |
| InChIKey | JTUSREPVZBBUHM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|