C17H10Cl3NO5S — CID 126098706
[2,4-dichloro-6-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126098706) has the molecular formula C17H10Cl3NO5S and a molecular weight of 446.70 g/mol. Its IUPAC name is [2,4-dichloro-6-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2,4-dichloro-6-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126098706 |
| Molecular Formula | C17H10Cl3NO5S |
| Molecular Weight | 446.70 g/mol |
| Exact Mass | 444.93 |
| IUPAC Name | [2,4-dichloro-6-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CC1=NOC(=O)/C1=C\c1cc(Cl)cc(Cl)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H10Cl3NO5S/c1-9-14(17(22)25-21-9)7-10-6-12(19)8-15(20)16(10)26-27(23,24)13-4-2-11(18)3-5-13/h2-8H,1H3/b14-7- |
| InChIKey | UWXJNYFRSJXVAN-AUWJEWJLSA-N |
| XLogP | 4.73 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.70 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|