C25H15Cl3N2O8S — CID 126075860
methyl 4-[(5E)-5-[[3,5-dichloro-2-(4-chlorophenyl)sulfonyloxyphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 126075860) has the molecular formula C25H15Cl3N2O8S and a molecular weight of 609.83 g/mol. Its IUPAC name is methyl 4-[(5E)-5-[[3,5-dichloro-2-(4-chlorophenyl)sulfonyloxyphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5E)-5-[[3,5-dichloro-2-(4-chlorophenyl)sulfonyloxyphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 126075860 |
| Molecular Formula | C25H15Cl3N2O8S |
| Molecular Weight | 609.83 g/mol |
| Exact Mass | 607.96 |
| IUPAC Name | methyl 4-[(5E)-5-[[3,5-dichloro-2-(4-chlorophenyl)sulfonyloxyphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)NC(=O)/C(=C\c3cc(Cl)cc(Cl)c3OS(=O)(=O)c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H15Cl3N2O8S/c1-37-24(33)13-2-6-17(7-3-13)30-23(32)19(22(31)29-25(30)34)11-14-10-16(27)12-20(28)21(14)38-39(35,36)18-8-4-15(26)5-9-18/h2-12H,1H3,(H,29,31,34)/b19-11+ |
| InChIKey | XWXAJFKQVGAGHD-YBFXNURJSA-N |
| XLogP | 4.87 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.83 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|