C22H14Cl2N2O6 — CID 2178942
methyl 4-[(5Z)-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 2178942) has the molecular formula C22H14Cl2N2O6 and a molecular weight of 473.27 g/mol. Its IUPAC name is methyl 4-[(5Z)-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5Z)-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 2178942 |
| Molecular Formula | C22H14Cl2N2O6 |
| Molecular Weight | 473.27 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | methyl 4-[(5Z)-5-[(3,5-dichloro-4-prop-2-ynoxyphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | C#CCOc1c(Cl)cc(/C=C2/C(=O)NC(=O)N(c3ccc(C(=O)OC)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C22H14Cl2N2O6/c1-3-8-32-18-16(23)10-12(11-17(18)24)9-15-19(27)25-22(30)26(20(15)28)14-6-4-13(5-7-14)21(29)31-2/h1,4-7,9-11H,8H2,2H3,(H,25,27,30)/b15-9- |
| InChIKey | SUKYZVOYCMSNOL-DHDCSXOGSA-N |
| XLogP | 3.46 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|