C18H15NO6S — CID 126093107
[2-methoxy-4-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] benzenesulfonate (PubChem CID 126093107) has the molecular formula C18H15NO6S and a molecular weight of 373.39 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] benzenesulfonate.
| Compound Name | [2-methoxy-4-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126093107 |
| Molecular Formula | C18H15NO6S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | [2-methoxy-4-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] benzenesulfonate |
| SMILES | COc1cc(/C=C2\C(=O)ON=C2C)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15NO6S/c1-12-15(18(20)24-19-12)10-13-8-9-16(17(11-13)23-2)25-26(21,22)14-6-4-3-5-7-14/h3-11H,1-2H3/b15-10- |
| InChIKey | AZLCKAXGIZKPMJ-GDNBJRDFSA-N |
| XLogP | 2.78 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|