C14H15NO5 — CID 177461741
(4E)-3-methyl-4-[(2,4,6-trimethoxyphenyl)methylidene]-1,2-oxazol-5-one (PubChem CID 177461741) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is (4E)-3-methyl-4-[(2,4,6-trimethoxyphenyl)methylidene]-1,2-oxazol-5-one.
| Compound Name | (4E)-3-methyl-4-[(2,4,6-trimethoxyphenyl)methylidene]-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 177461741 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (4E)-3-methyl-4-[(2,4,6-trimethoxyphenyl)methylidene]-1,2-oxazol-5-one |
| SMILES | COc1cc(OC)c(/C=C2/C(=O)ON=C2C)c(OC)c1 |
| InChI | InChI=1S/C14H15NO5/c1-8-10(14(16)20-15-8)7-11-12(18-3)5-9(17-2)6-13(11)19-4/h5-7H,1-4H3/b10-7+ |
| InChIKey | SNMNYGCRNCPPSG-JXMROGBWSA-N |
| XLogP | 2.03 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|