C12H11NO2 — CID 718659
(4E)-3-methyl-4-[(4-methylphenyl)methylidene]-1,2-oxazol-5-one (PubChem CID 718659) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is (4E)-3-methyl-4-[(4-methylphenyl)methylidene]-1,2-oxazol-5-one.
| Compound Name | (4E)-3-methyl-4-[(4-methylphenyl)methylidene]-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 718659 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (4E)-3-methyl-4-[(4-methylphenyl)methylidene]-1,2-oxazol-5-one |
| SMILES | CC1=NOC(=O)/C1=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C12H11NO2/c1-8-3-5-10(6-4-8)7-11-9(2)13-15-12(11)14/h3-7H,1-2H3/b11-7+ |
| InChIKey | YXVQOTXQCWJCNJ-YRNVUSSQSA-N |
| XLogP | 2.31 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|