C17H12BrNO2 — CID 4573635
3-(4-bromophenyl)-4-[(4-methylphenyl)methylidene]-1,2-oxazol-5-one (PubChem CID 4573635) has the molecular formula C17H12BrNO2 and a molecular weight of 342.19 g/mol. Its IUPAC name is 3-(4-bromophenyl)-4-[(4-methylphenyl)methylidene]-1,2-oxazol-5-one.
| Compound Name | 3-(4-bromophenyl)-4-[(4-methylphenyl)methylidene]-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 4573635 |
| Molecular Formula | C17H12BrNO2 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 3-(4-bromophenyl)-4-[(4-methylphenyl)methylidene]-1,2-oxazol-5-one |
| SMILES | Cc1ccc(C=C2C(=O)ON=C2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H12BrNO2/c1-11-2-4-12(5-3-11)10-15-16(19-21-17(15)20)13-6-8-14(18)9-7-13/h2-10H,1H3 |
| InChIKey | NGPSDDZZBBKNJO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|