C22H15NO2 — CID 4268049
4-benzylidene-3-(4-phenylphenyl)-1,2-oxazol-5-one (PubChem CID 4268049) has the molecular formula C22H15NO2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-benzylidene-3-(4-phenylphenyl)-1,2-oxazol-5-one.
| Compound Name | 4-benzylidene-3-(4-phenylphenyl)-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 4268049 |
| Molecular Formula | C22H15NO2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-benzylidene-3-(4-phenylphenyl)-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2ccc(-c3ccccc3)cc2)C1=Cc1ccccc1 |
| InChI | InChI=1S/C22H15NO2/c24-22-20(15-16-7-3-1-4-8-16)21(23-25-22)19-13-11-18(12-14-19)17-9-5-2-6-10-17/h1-15H |
| InChIKey | ZEFGGNIQJNZAFO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|