C11H8BrNO2 — CID 6048164
(4E)-4-[(3-bromophenyl)methylidene]-3-methyl-1,2-oxazol-5-one (PubChem CID 6048164) has the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. Its IUPAC name is (4E)-4-[(3-bromophenyl)methylidene]-3-methyl-1,2-oxazol-5-one.
| Compound Name | (4E)-4-[(3-bromophenyl)methylidene]-3-methyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 6048164 |
| Molecular Formula | C11H8BrNO2 |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | (4E)-4-[(3-bromophenyl)methylidene]-3-methyl-1,2-oxazol-5-one |
| SMILES | CC1=NOC(=O)/C1=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C11H8BrNO2/c1-7-10(11(14)15-13-7)6-8-3-2-4-9(12)5-8/h2-6H,1H3/b10-6+ |
| InChIKey | RSTVYWDIZPXWMQ-UXBLZVDNSA-N |
| XLogP | 2.77 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|