C14H12BrNO5 — CID 3818357
[2-bromo-6-methoxy-4-[(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] acetate (PubChem CID 3818357) has the molecular formula C14H12BrNO5 and a molecular weight of 354.16 g/mol. Its IUPAC name is [2-bromo-6-methoxy-4-[(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] acetate.
| Compound Name | [2-bromo-6-methoxy-4-[(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 3818357 |
| Molecular Formula | C14H12BrNO5 |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | [2-bromo-6-methoxy-4-[(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] acetate |
| SMILES | COc1cc(C=C2C(=O)ON=C2C)cc(Br)c1OC(C)=O |
| InChI | InChI=1S/C14H12BrNO5/c1-7-10(14(18)21-16-7)4-9-5-11(15)13(20-8(2)17)12(6-9)19-3/h4-6H,1-3H3 |
| InChIKey | KYNBLFAQILKJPE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|