C25H28O7 — CID 46886189
(2E,5E)-2,5-bis[(2,4,6-trimethoxyphenyl)methylidene]cyclopentan-1-one (PubChem CID 46886189) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is (2E,5E)-2,5-bis[(2,4,6-trimethoxyphenyl)methylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2,5-bis[(2,4,6-trimethoxyphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 46886189 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (2E,5E)-2,5-bis[(2,4,6-trimethoxyphenyl)methylidene]cyclopentan-1-one |
| SMILES | COc1cc(OC)c(/C=C2\CC/C(=C\c3c(OC)cc(OC)cc3OC)C2=O)c(OC)c1 |
| InChI | InChI=1S/C25H28O7/c1-27-17-11-21(29-3)19(22(12-17)30-4)9-15-7-8-16(25(15)26)10-20-23(31-5)13-18(28-2)14-24(20)32-6/h9-14H,7-8H2,1-6H3/b15-9+,16-10+ |
| InChIKey | MUTUGFSRVAGHJL-KAVGSWPWSA-N |
| XLogP | 4.57 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|