C22H22O4 — CID 154190116
(5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(2-methoxyphenyl)methylidene]cyclopentan-1-one (PubChem CID 154190116) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is (5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(2-methoxyphenyl)methylidene]cyclopentan-1-one.
| Compound Name | (5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(2-methoxyphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 154190116 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(2-methoxyphenyl)methylidene]cyclopentan-1-one |
| SMILES | COc1cc(C=C2CC/C(=C\c3ccccc3OC)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C22H22O4/c1-24-19-11-15(12-20(14-19)25-2)10-17-8-9-18(22(17)23)13-16-6-4-5-7-21(16)26-3/h4-7,10-14H,8-9H2,1-3H3/b17-10?,18-13+ |
| InChIKey | HHWFLPLJHFXXBZ-BLKVHLKTSA-N |
| XLogP | 4.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|