C27H30O3 — CID 154177036
(2E)-2-[cyclohexyl(phenyl)methylidene]-5-[(3,5-dimethoxyphenyl)methylidene]cyclopentan-1-one (PubChem CID 154177036) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is (2E)-2-[cyclohexyl(phenyl)methylidene]-5-[(3,5-dimethoxyphenyl)methylidene]cyclopentan-1-one.
| Compound Name | (2E)-2-[cyclohexyl(phenyl)methylidene]-5-[(3,5-dimethoxyphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 154177036 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (2E)-2-[cyclohexyl(phenyl)methylidene]-5-[(3,5-dimethoxyphenyl)methylidene]cyclopentan-1-one |
| SMILES | COc1cc(C=C2CC/C(=C(\c3ccccc3)C3CCCCC3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C27H30O3/c1-29-23-16-19(17-24(18-23)30-2)15-22-13-14-25(27(22)28)26(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3,5-6,9-10,15-18,21H,4,7-8,11-14H2,1-2H3/b22-15?,26-25- |
| InChIKey | UBSNUCCMZUXFKV-STSLPAAISA-N |
| XLogP | 6.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|