C16H18O2S2 — CID 3338854
2-[bis(methylsulfanyl)methylidene]-5-[(4-methoxyphenyl)methylidene]cyclopentan-1-one (PubChem CID 3338854) has the molecular formula C16H18O2S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 2-[bis(methylsulfanyl)methylidene]-5-[(4-methoxyphenyl)methylidene]cyclopentan-1-one.
| Compound Name | 2-[bis(methylsulfanyl)methylidene]-5-[(4-methoxyphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 3338854 |
| Molecular Formula | C16H18O2S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-[bis(methylsulfanyl)methylidene]-5-[(4-methoxyphenyl)methylidene]cyclopentan-1-one |
| SMILES | COc1ccc(C=C2CCC(=C(SC)SC)C2=O)cc1 |
| InChI | InChI=1S/C16H18O2S2/c1-18-13-7-4-11(5-8-13)10-12-6-9-14(15(12)17)16(19-2)20-3/h4-5,7-8,10H,6,9H2,1-3H3 |
| InChIKey | KDPRFAAFGQHLEB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|