C21H20O3 — CID 154112357
(2E)-2-benzylidene-5-[(3,5-dimethoxyphenyl)methylidene]cyclopentan-1-one (PubChem CID 154112357) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2E)-2-benzylidene-5-[(3,5-dimethoxyphenyl)methylidene]cyclopentan-1-one.
| Compound Name | (2E)-2-benzylidene-5-[(3,5-dimethoxyphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 154112357 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (2E)-2-benzylidene-5-[(3,5-dimethoxyphenyl)methylidene]cyclopentan-1-one |
| SMILES | COc1cc(C=C2CC/C(=C\c3ccccc3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C21H20O3/c1-23-19-12-16(13-20(14-19)24-2)11-18-9-8-17(21(18)22)10-15-6-4-3-5-7-15/h3-7,10-14H,8-9H2,1-2H3/b17-10+,18-11? |
| InChIKey | LYBVLLPOUZGUBV-DBHUVCNSSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|