C21H19FO3 — CID 154186564
(5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(2-fluorophenyl)methylidene]cyclopentan-1-one (PubChem CID 154186564) has the molecular formula C21H19FO3 and a molecular weight of 338.38 g/mol. Its IUPAC name is (5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(2-fluorophenyl)methylidene]cyclopentan-1-one.
| Compound Name | (5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(2-fluorophenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 154186564 |
| Molecular Formula | C21H19FO3 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(2-fluorophenyl)methylidene]cyclopentan-1-one |
| SMILES | COc1cc(C=C2CC/C(=C\c3ccccc3F)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C21H19FO3/c1-24-18-10-14(11-19(13-18)25-2)9-16-7-8-17(21(16)23)12-15-5-3-4-6-20(15)22/h3-6,9-13H,7-8H2,1-2H3/b16-9?,17-12+ |
| InChIKey | SGJYWJFLHSRXRJ-KJTLWPSMSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|