C22H22O5S — CID 154183912
(5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(4-methylsulfonylphenyl)methylidene]cyclopentan-1-one (PubChem CID 154183912) has the molecular formula C22H22O5S and a molecular weight of 398.48 g/mol. Its IUPAC name is (5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(4-methylsulfonylphenyl)methylidene]cyclopentan-1-one.
| Compound Name | (5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(4-methylsulfonylphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 154183912 |
| Molecular Formula | C22H22O5S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (5E)-2-[(3,5-dimethoxyphenyl)methylidene]-5-[(4-methylsulfonylphenyl)methylidene]cyclopentan-1-one |
| SMILES | COc1cc(C=C2CC/C(=C\c3ccc(S(C)(=O)=O)cc3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C22H22O5S/c1-26-19-12-16(13-20(14-19)27-2)11-18-7-6-17(22(18)23)10-15-4-8-21(9-5-15)28(3,24)25/h4-5,8-14H,6-7H2,1-3H3/b17-10+,18-11? |
| InChIKey | KZQHKIYULSFIAT-DBHUVCNSSA-N |
| XLogP | 3.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|