C22H18Cl3NO5S — CID 2742135
[2,4-dichloro-6-[(4-chloro-2,5-dimethoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 2742135) has the molecular formula C22H18Cl3NO5S and a molecular weight of 514.81 g/mol. Its IUPAC name is [2,4-dichloro-6-[(4-chloro-2,5-dimethoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,4-dichloro-6-[(4-chloro-2,5-dimethoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2742135 |
| Molecular Formula | C22H18Cl3NO5S |
| Molecular Weight | 514.81 g/mol |
| Exact Mass | 513.00 |
| IUPAC Name | [2,4-dichloro-6-[(4-chloro-2,5-dimethoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(/N=C/c2cc(Cl)cc(Cl)c2OS(=O)(=O)c2ccc(C)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C22H18Cl3NO5S/c1-13-4-6-16(7-5-13)32(27,28)31-22-14(8-15(23)9-18(22)25)12-26-19-11-20(29-2)17(24)10-21(19)30-3/h4-12H,1-3H3/b26-12+ |
| InChIKey | CTKTZPWPWINIDP-RPPGKUMJSA-N |
| XLogP | 6.49 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.81 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|