C23H22ClN3O7S — CID 139060299
acetic acid;[4-chloro-2-methoxy-6-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 139060299) has the molecular formula C23H22ClN3O7S and a molecular weight of 519.96 g/mol. Its IUPAC name is acetic acid;[4-chloro-2-methoxy-6-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | acetic acid;[4-chloro-2-methoxy-6-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139060299 |
| Molecular Formula | C23H22ClN3O7S |
| Molecular Weight | 519.96 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | acetic acid;[4-chloro-2-methoxy-6-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CC(=O)O.COc1cc(Cl)cc(/C=N/NC(=O)c2ccncc2)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H18ClN3O5S.C2H4O2/c1-14-3-5-18(6-4-14)31(27,28)30-20-16(11-17(22)12-19(20)29-2)13-24-25-21(26)15-7-9-23-10-8-15;1-2(3)4/h3-13H,1-2H3,(H,25,26);1H3,(H,3,4)/b24-13+; |
| InChIKey | DRGLUPZQOKYYDV-KEJAMGHHSA-N |
| XLogP | 3.67 |
| TPSA | 144.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.96 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|