C12H18ClNO — CID 62450743
2-(4-chloro-2,6-dimethylphenoxy)-N-methylpropan-1-amine (PubChem CID 62450743) has the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is 2-(4-chloro-2,6-dimethylphenoxy)-N-methylpropan-1-amine.
| Compound Name | 2-(4-chloro-2,6-dimethylphenoxy)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 62450743 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-(4-chloro-2,6-dimethylphenoxy)-N-methylpropan-1-amine |
| SMILES | CNCC(C)Oc1c(C)cc(Cl)cc1C |
| InChI | InChI=1S/C12H18ClNO/c1-8-5-11(13)6-9(2)12(8)15-10(3)7-14-4/h5-6,10,14H,7H2,1-4H3 |
| InChIKey | BUPREYARUFIUES-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |