C11H16Cl2O2 — CID 158865667
(3,5-dichloro-4-propan-2-yloxyphenyl)methanol;methane (PubChem CID 158865667) has the molecular formula C11H16Cl2O2 and a molecular weight of 251.15 g/mol. Its IUPAC name is (3,5-dichloro-4-propan-2-yloxyphenyl)methanol;methane.
| Compound Name | (3,5-dichloro-4-propan-2-yloxyphenyl)methanol;methane |
|---|---|
| PubChem CID | 158865667 |
| Molecular Formula | C11H16Cl2O2 |
| Molecular Weight | 251.15 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | (3,5-dichloro-4-propan-2-yloxyphenyl)methanol;methane |
| SMILES | C.CC(C)Oc1c(Cl)cc(CO)cc1Cl |
| InChI | InChI=1S/C10H12Cl2O2.CH4/c1-6(2)14-10-8(11)3-7(5-13)4-9(10)12;/h3-4,6,13H,5H2,1-2H3;1H4 |
| InChIKey | JBEUZAUODZQPOI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.15 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |