C15H12Cl3F5O2 — CID 157172540
methane;1,2,3,4,5-pentafluoro-6-methoxybenzene;1,3,5-trichloro-2-methoxybenzene (PubChem CID 157172540) has the molecular formula C15H12Cl3F5O2 and a molecular weight of 425.61 g/mol. Its IUPAC name is methane;1,2,3,4,5-pentafluoro-6-methoxybenzene;1,3,5-trichloro-2-methoxybenzene.
| Compound Name | methane;1,2,3,4,5-pentafluoro-6-methoxybenzene;1,3,5-trichloro-2-methoxybenzene |
|---|---|
| PubChem CID | 157172540 |
| Molecular Formula | C15H12Cl3F5O2 |
| Molecular Weight | 425.61 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | methane;1,2,3,4,5-pentafluoro-6-methoxybenzene;1,3,5-trichloro-2-methoxybenzene |
| SMILES | C.COc1c(Cl)cc(Cl)cc1Cl.COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H5Cl3O.C7H3F5O.CH4/c1-11-7-5(9)2-4(8)3-6(7)10;1-13-7-5(11)3(9)2(8)4(10)6(7)12;/h2-3H,1H3;1H3;1H4 |
| InChIKey | ANQHHKWBXJMKTP-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.61 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|