N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride

C9H8Cl3NO2 — CID 115194513

IUPACN-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride
SMILESCOc1c(Cl)cc(Cl)cc1N(C)C(=O)Cl
InChIInChI=1S/C9H8Cl3NO2/c1-13(9(12)14)7-4-5(10)3-6(11)8(7)15-2/h3-4H,1-2H3
InChIKeyABXOSTOCTSUQJX-UHFFFAOYSA-N
MW268.53 g/mol
LogP3.80
Rot. Bonds2

About N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride

N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride (PubChem CID 115194513) has the molecular formula C9H8Cl3NO2 and a molecular weight of 268.53 g/mol. Its IUPAC name is N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride.

Molecular Properties

Compound NameN-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride
PubChem CID115194513
Molecular FormulaC9H8Cl3NO2
Molecular Weight268.53 g/mol
Exact Mass266.96
IUPAC NameN-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride
SMILESCOc1c(Cl)cc(Cl)cc1N(C)C(=O)Cl
InChIInChI=1S/C9H8Cl3NO2/c1-13(9(12)14)7-4-5(10)3-6(11)8(7)15-2/h3-4H,1-2H3
InChIKeyABXOSTOCTSUQJX-UHFFFAOYSA-N
XLogP3.80
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.53
LogP ≤ 53.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride?
The IUPAC name of N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride (CID 115194513) is N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride.
What is the SMILES notation for N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride?
The canonical SMILES for N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride is COc1c(Cl)cc(Cl)cc1N(C)C(=O)Cl.
What is the InChIKey of N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride?
The InChIKey is ABXOSTOCTSUQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl3NO2/c1-13(9(12)14)7-4-5(10)3-6(11)8(7)15-2/h3-4H,1-2H3.
What are the key properties of N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride?
N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride has a molecular weight of 268.53 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dichloro-2-methoxyphenyl)-N-methylcarbamoyl chloride is sourced from PubChem (CID 115194513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).