C7H7Cl2NO — CID 11217747
3,5-dichloro-2-methoxyaniline (PubChem CID 11217747) has the molecular formula C7H7Cl2NO and a molecular weight of 192.05 g/mol. Its IUPAC name is 3,5-dichloro-2-methoxyaniline.
| Compound Name | 3,5-dichloro-2-methoxyaniline |
|---|---|
| PubChem CID | 11217747 |
| Molecular Formula | C7H7Cl2NO |
| Molecular Weight | 192.05 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | 3,5-dichloro-2-methoxyaniline |
| SMILES | COc1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C7H7Cl2NO/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,10H2,1H3 |
| InChIKey | FCNJFFUXQXCKFS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.05 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|