C9H11Cl2NOS — CID 116830511
2-amino-2-(3,5-dichloro-2-methoxyphenyl)ethanethiol (PubChem CID 116830511) has the molecular formula C9H11Cl2NOS and a molecular weight of 252.17 g/mol. Its IUPAC name is 2-amino-2-(3,5-dichloro-2-methoxyphenyl)ethanethiol.
| Compound Name | 2-amino-2-(3,5-dichloro-2-methoxyphenyl)ethanethiol |
|---|---|
| PubChem CID | 116830511 |
| Molecular Formula | C9H11Cl2NOS |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 2-amino-2-(3,5-dichloro-2-methoxyphenyl)ethanethiol |
| SMILES | COc1c(Cl)cc(Cl)cc1C(N)CS |
| InChI | InChI=1S/C9H11Cl2NOS/c1-13-9-6(8(12)4-14)2-5(10)3-7(9)11/h2-3,8,14H,4,12H2,1H3 |
| InChIKey | ZPLHRHFPVKSMEH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|