About 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene
1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene (PubChem CID 130926131) has the molecular formula C7H3Cl2F3O
and a molecular weight of 231.00 g/mol. Its IUPAC name is 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene.
Molecular Properties
| Compound Name | 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene |
| PubChem CID | 130926131 |
| Molecular Formula | C7H3Cl2F3O |
| Molecular Weight | 231.00 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene |
| SMILES | COc1c(F)c(F)c(F)c(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl2F3O/c1-13-7-3(9)2(8)4(10)5(11)6(7)12/h1H3 |
| InChIKey | FYLSCPZEHCVAMF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.00 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene?
The IUPAC name of 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene (CID 130926131) is 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene.
What is the SMILES notation for 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene?
The canonical SMILES for 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene is COc1c(F)c(F)c(F)c(Cl)c1Cl.
What is the InChIKey of 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene?
The InChIKey is FYLSCPZEHCVAMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Cl2F3O/c1-13-7-3(9)2(8)4(10)5(11)6(7)12/h1H3.
What are the key properties of 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene?
1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene has a molecular weight of 231.00 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene is sourced from PubChem (CID 130926131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).