C7H3Cl2F3O — CID 130926131
1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene (PubChem CID 130926131) has the molecular formula C7H3Cl2F3O and a molecular weight of 231.00 g/mol. Its IUPAC name is 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene.
| Compound Name | 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene |
|---|---|
| PubChem CID | 130926131 |
| Molecular Formula | C7H3Cl2F3O |
| Molecular Weight | 231.00 g/mol |
| Exact Mass | 229.95 |
| IUPAC Name | 1,2-dichloro-3,4,5-trifluoro-6-methoxybenzene |
| SMILES | COc1c(F)c(F)c(F)c(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl2F3O/c1-13-7-3(9)2(8)4(10)5(11)6(7)12/h1H3 |
| InChIKey | FYLSCPZEHCVAMF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.00 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|