C7H3Cl5O — CID 129318206
1,2,3,4,5-pentachloro-6-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (PubChem CID 129318206) has the molecular formula C7H3Cl5O and a molecular weight of 286.32 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene.
| Compound Name | 1,2,3,4,5-pentachloro-6-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 129318206 |
| Molecular Formula | C7H3Cl5O |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 283.88 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| SMILES | CO[13c]1[13c](Cl)[13c](Cl)[13c](Cl)[13c](Cl)[13c]1Cl |
| InChI | InChI=1S/C7H3Cl5O/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h1H3/i2+1,3+1,4+1,5+1,6+1,7+1 |
| InChIKey | BBABSCYTNHOKOG-WBJZHHNVSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|