About CID 152785623
CID 152785623 (PubChem CID 152785623) has the molecular formula C19H4Cl12O6P-
and a molecular weight of 784.64 g/mol.
Molecular Properties
| Compound Name | CID 152785623 |
| PubChem CID | 152785623 |
| Molecular Formula | C19H4Cl12O6P- |
| Molecular Weight | 784.64 g/mol |
| Exact Mass | 778.60 |
| IUPAC Name | — |
| SMILES | COc1c(Cl)c(Cl)c(Cl)c(Cl)c1O[PH-]12(Oc3c(Cl)c(Cl)c(Cl)c(Cl)c3O1)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1O2 |
| InChI | InChI=1S/C19H4Cl12O6P/c1-32-14-8(26)2(20)3(21)9(27)15(14)33-38(34-16-10(28)4(22)5(23)11(29)17(16)35-38)36-18-12(30)6(24)7(25)13(31)19(18)37-38/h38H,1H3/q-1 |
| InChIKey | RWWWUJFCKVQUNL-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 784.64 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 152785623 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 152785623?
The IUPAC name of CID 152785623 (CID 152785623) is not available.
What is the SMILES notation for CID 152785623?
The canonical SMILES for CID 152785623 is COc1c(Cl)c(Cl)c(Cl)c(Cl)c1O[PH-]12(Oc3c(Cl)c(Cl)c(Cl)c(Cl)c3O1)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1O2.
What is the InChIKey of CID 152785623?
The InChIKey is RWWWUJFCKVQUNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H4Cl12O6P/c1-32-14-8(26)2(20)3(21)9(27)15(14)33-38(34-16-10(28)4(22)5(23)11(29)17(16)35-38)36-18-12(30)6(24)7(25)13(31)19(18)37-38/h38H,1H3/q-1.
What are the key properties of CID 152785623?
CID 152785623 has a molecular weight of 784.64 g/mol, XLogP of 12.72, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 152785623 is sourced from PubChem (CID 152785623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).