C7H3BrCl4O — CID 91748514
1-bromo-2,3,5,6-tetrachloro-4-methoxybenzene (PubChem CID 91748514) has the molecular formula C7H3BrCl4O and a molecular weight of 324.82 g/mol. Its IUPAC name is 1-bromo-2,3,5,6-tetrachloro-4-methoxybenzene.
| Compound Name | 1-bromo-2,3,5,6-tetrachloro-4-methoxybenzene |
|---|---|
| PubChem CID | 91748514 |
| Molecular Formula | C7H3BrCl4O |
| Molecular Weight | 324.82 g/mol |
| Exact Mass | 321.81 |
| IUPAC Name | 1-bromo-2,3,5,6-tetrachloro-4-methoxybenzene |
| SMILES | COc1c(Cl)c(Cl)c(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C7H3BrCl4O/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h1H3 |
| InChIKey | YSVAURKXNCNUNS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.82 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|