C9H10BrClO — CID 84803778
1-bromo-4-chloro-3-methoxy-2,5-dimethylbenzene (PubChem CID 84803778) has the molecular formula C9H10BrClO and a molecular weight of 249.53 g/mol. Its IUPAC name is 1-bromo-4-chloro-3-methoxy-2,5-dimethylbenzene.
| Compound Name | 1-bromo-4-chloro-3-methoxy-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 84803778 |
| Molecular Formula | C9H10BrClO |
| Molecular Weight | 249.53 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 1-bromo-4-chloro-3-methoxy-2,5-dimethylbenzene |
| SMILES | COc1c(C)c(Br)cc(C)c1Cl |
| InChI | InChI=1S/C9H10BrClO/c1-5-4-7(10)6(2)9(12-3)8(5)11/h4H,1-3H3 |
| InChIKey | OOJVPGNPVYRDPX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |