C9H10BrClO2 — CID 84711440
1-bromo-5-chloro-3,4-dimethoxy-2-methylbenzene (PubChem CID 84711440) has the molecular formula C9H10BrClO2 and a molecular weight of 265.53 g/mol. Its IUPAC name is 1-bromo-5-chloro-3,4-dimethoxy-2-methylbenzene.
| Compound Name | 1-bromo-5-chloro-3,4-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 84711440 |
| Molecular Formula | C9H10BrClO2 |
| Molecular Weight | 265.53 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | 1-bromo-5-chloro-3,4-dimethoxy-2-methylbenzene |
| SMILES | COc1c(Cl)cc(Br)c(C)c1OC |
| InChI | InChI=1S/C9H10BrClO2/c1-5-6(10)4-7(11)9(13-3)8(5)12-2/h4H,1-3H3 |
| InChIKey | PVHHCAVBZHMMJH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |