C11H15ClO3 — CID 84694066
1-(5-chloro-3,4-dimethoxy-2-methylphenyl)ethanol (PubChem CID 84694066) has the molecular formula C11H15ClO3 and a molecular weight of 230.69 g/mol. Its IUPAC name is 1-(5-chloro-3,4-dimethoxy-2-methylphenyl)ethanol.
| Compound Name | 1-(5-chloro-3,4-dimethoxy-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 84694066 |
| Molecular Formula | C11H15ClO3 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-(5-chloro-3,4-dimethoxy-2-methylphenyl)ethanol |
| SMILES | COc1c(Cl)cc(C(C)O)c(C)c1OC |
| InChI | InChI=1S/C11H15ClO3/c1-6-8(7(2)13)5-9(12)11(15-4)10(6)14-3/h5,7,13H,1-4H3 |
| InChIKey | WJLCEERWYVFLRI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |