C10H12Cl2O3 — CID 85213872
1-(3,5-dichloro-4-methoxyphenyl)propane-1,2-diol (PubChem CID 85213872) has the molecular formula C10H12Cl2O3 and a molecular weight of 251.11 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-methoxyphenyl)propane-1,2-diol.
| Compound Name | 1-(3,5-dichloro-4-methoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 85213872 |
| Molecular Formula | C10H12Cl2O3 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 1-(3,5-dichloro-4-methoxyphenyl)propane-1,2-diol |
| SMILES | COc1c(Cl)cc(C(O)C(C)O)cc1Cl |
| InChI | InChI=1S/C10H12Cl2O3/c1-5(13)9(14)6-3-7(11)10(15-2)8(12)4-6/h3-5,9,13-14H,1-2H3 |
| InChIKey | MDZJODGNHBYYAE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |