C10H13ClO3 — CID 10353281
(1R,2S)-1-(3-chloro-4-methoxyphenyl)propane-1,2-diol (PubChem CID 10353281) has the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. Its IUPAC name is (1R,2S)-1-(3-chloro-4-methoxyphenyl)propane-1,2-diol.
| Compound Name | (1R,2S)-1-(3-chloro-4-methoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 10353281 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (1R,2S)-1-(3-chloro-4-methoxyphenyl)propane-1,2-diol |
| SMILES | COc1ccc([C@@H](O)[C@H](C)O)cc1Cl |
| InChI | InChI=1S/C10H13ClO3/c1-6(12)10(13)7-3-4-9(14-2)8(11)5-7/h3-6,10,12-13H,1-2H3/t6-,10-/m0/s1 |
| InChIKey | AZXJGOGDICMETN-WKEGUHRASA-N |
| XLogP | 1.76 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |