C12H19ClO3 — CID 145244698
4-chloro-1,2,3-trimethoxy-5-methylbenzene;ethane (PubChem CID 145244698) has the molecular formula C12H19ClO3 and a molecular weight of 246.73 g/mol. Its IUPAC name is 4-chloro-1,2,3-trimethoxy-5-methylbenzene;ethane.
| Compound Name | 4-chloro-1,2,3-trimethoxy-5-methylbenzene;ethane |
|---|---|
| PubChem CID | 145244698 |
| Molecular Formula | C12H19ClO3 |
| Molecular Weight | 246.73 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 4-chloro-1,2,3-trimethoxy-5-methylbenzene;ethane |
| SMILES | CC.COc1cc(C)c(Cl)c(OC)c1OC |
| InChI | InChI=1S/C10H13ClO3.C2H6/c1-6-5-7(12-2)9(13-3)10(14-4)8(6)11;1-2/h5H,1-4H3;1-2H3 |
| InChIKey | AASWDJGCSBZLFN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.73 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |