C7H3Cl4IO — CID 86035414
1,2,4,5-tetrachloro-3-iodo-6-methoxybenzene (PubChem CID 86035414) has the molecular formula C7H3Cl4IO and a molecular weight of 371.82 g/mol. Its IUPAC name is 1,2,4,5-tetrachloro-3-iodo-6-methoxybenzene.
| Compound Name | 1,2,4,5-tetrachloro-3-iodo-6-methoxybenzene |
|---|---|
| PubChem CID | 86035414 |
| Molecular Formula | C7H3Cl4IO |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 369.80 |
| IUPAC Name | 1,2,4,5-tetrachloro-3-iodo-6-methoxybenzene |
| SMILES | COc1c(Cl)c(Cl)c(I)c(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl4IO/c1-13-7-4(10)2(8)6(12)3(9)5(7)11/h1H3 |
| InChIKey | GQEZUBWHZIBHCY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|