C9H9I3O3 — CID 15832239
1,3,5-triiodo-2,4,6-trimethoxybenzene (PubChem CID 15832239) has the molecular formula C9H9I3O3 and a molecular weight of 545.88 g/mol. Its IUPAC name is 1,3,5-triiodo-2,4,6-trimethoxybenzene.
| Compound Name | 1,3,5-triiodo-2,4,6-trimethoxybenzene |
|---|---|
| PubChem CID | 15832239 |
| Molecular Formula | C9H9I3O3 |
| Molecular Weight | 545.88 g/mol |
| Exact Mass | 545.77 |
| IUPAC Name | 1,3,5-triiodo-2,4,6-trimethoxybenzene |
| SMILES | COc1c(I)c(OC)c(I)c(OC)c1I |
| InChI | InChI=1S/C9H9I3O3/c1-13-7-4(10)8(14-2)6(12)9(15-3)5(7)11/h1-3H3 |
| InChIKey | ZSAABVYALVNZNX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|