C22H26O8 — CID 174988413
1,2,3,4,5,6,7,8-octamethoxyanthracene (PubChem CID 174988413) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octamethoxyanthracene.
| Compound Name | 1,2,3,4,5,6,7,8-octamethoxyanthracene |
|---|---|
| PubChem CID | 174988413 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octamethoxyanthracene |
| SMILES | COc1c(OC)c(OC)c2cc3c(OC)c(OC)c(OC)c(OC)c3cc2c1OC |
| InChI | InChI=1S/C22H26O8/c1-23-15-11-9-13-14(10-12(11)16(24-2)20(28-6)19(15)27-5)18(26-4)22(30-8)21(29-7)17(13)25-3/h9-10H,1-8H3 |
| InChIKey | USQORNIYKDGBEZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|