C9H9ClFIO2 — CID 139324179
1-chloro-3-fluoro-2-iodo-4,6-dimethoxy-5-methylbenzene (PubChem CID 139324179) has the molecular formula C9H9ClFIO2 and a molecular weight of 330.52 g/mol. Its IUPAC name is 1-chloro-3-fluoro-2-iodo-4,6-dimethoxy-5-methylbenzene.
| Compound Name | 1-chloro-3-fluoro-2-iodo-4,6-dimethoxy-5-methylbenzene |
|---|---|
| PubChem CID | 139324179 |
| Molecular Formula | C9H9ClFIO2 |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | 1-chloro-3-fluoro-2-iodo-4,6-dimethoxy-5-methylbenzene |
| SMILES | COc1c(C)c(OC)c(Cl)c(I)c1F |
| InChI | InChI=1S/C9H9ClFIO2/c1-4-8(13-2)5(10)7(12)6(11)9(4)14-3/h1-3H3 |
| InChIKey | FWMQDWOAWSOSOY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|