C11H12F2O3 — CID 175220601
1-(2,6-difluoro-3,5-dimethoxy-4-methylphenyl)ethanone (PubChem CID 175220601) has the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. Its IUPAC name is 1-(2,6-difluoro-3,5-dimethoxy-4-methylphenyl)ethanone.
| Compound Name | 1-(2,6-difluoro-3,5-dimethoxy-4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 175220601 |
| Molecular Formula | C11H12F2O3 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-(2,6-difluoro-3,5-dimethoxy-4-methylphenyl)ethanone |
| SMILES | COc1c(C)c(OC)c(F)c(C(C)=O)c1F |
| InChI | InChI=1S/C11H12F2O3/c1-5-10(15-3)8(12)7(6(2)14)9(13)11(5)16-4/h1-4H3 |
| InChIKey | PLRCAWPIQMJUME-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |