C8H4F4O2 — CID 19004302
1-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)ethanone (PubChem CID 19004302) has the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. Its IUPAC name is 1-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)ethanone.
| Compound Name | 1-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 19004302 |
| Molecular Formula | C8H4F4O2 |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 1-(2,3,5,6-tetrafluoro-4-hydroxyphenyl)ethanone |
| SMILES | CC(=O)c1c(F)c(F)c(O)c(F)c1F |
| InChI | InChI=1S/C8H4F4O2/c1-2(13)3-4(9)6(11)8(14)7(12)5(3)10/h14H,1H3 |
| InChIKey | LWRKIWGVOONOCG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|