C10H8F3NO2 — CID 87737254
1-(2-acetyl-6-amino-3,4,5-trifluorophenyl)ethanone (PubChem CID 87737254) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 1-(2-acetyl-6-amino-3,4,5-trifluorophenyl)ethanone.
| Compound Name | 1-(2-acetyl-6-amino-3,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 87737254 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 1-(2-acetyl-6-amino-3,4,5-trifluorophenyl)ethanone |
| SMILES | CC(=O)c1c(N)c(F)c(F)c(F)c1C(C)=O |
| InChI | InChI=1S/C10H8F3NO2/c1-3(15)5-6(4(2)16)10(14)9(13)8(12)7(5)11/h14H2,1-2H3 |
| InChIKey | JBSPXAFYVJPXJO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|