C8H6F2INO — CID 164916898
1-(6-amino-2,4-difluoro-3-iodophenyl)ethanone (PubChem CID 164916898) has the molecular formula C8H6F2INO and a molecular weight of 297.04 g/mol. Its IUPAC name is 1-(6-amino-2,4-difluoro-3-iodophenyl)ethanone.
| Compound Name | 1-(6-amino-2,4-difluoro-3-iodophenyl)ethanone |
|---|---|
| PubChem CID | 164916898 |
| Molecular Formula | C8H6F2INO |
| Molecular Weight | 297.04 g/mol |
| Exact Mass | 296.95 |
| IUPAC Name | 1-(6-amino-2,4-difluoro-3-iodophenyl)ethanone |
| SMILES | CC(=O)c1c(N)cc(F)c(I)c1F |
| InChI | InChI=1S/C8H6F2INO/c1-3(13)6-5(12)2-4(9)8(11)7(6)10/h2H,12H2,1H3 |
| InChIKey | QEFIMLGLIWURID-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.04 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|